Organofluorine chemistry:
science, technologies, manufacture since 1987
1,16-Dichloroperfluorohexadecane
OBDepict F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F
Capacity per Month: 50 kg

Catalog Number: 1155

CAS: 1555-20-0

MDL number: MFCD16620565

Purity: 97%

Molecular Formula: C16Cl2F32

Molecular Weight: 871.03

Physical properties

Melting Point, °C: 140

Additional information

Irritant

SMILES: FC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F

Order