Organofluorine chemistry:
science, technologies, manufacture since 1987
Bis(7-methoxycarbonylperfluoro-4,7-dimethyl-3,6-dioxaheptyl) disulfide
OBDepict O O S S O O F F F F F F F F F F F F F F F F F HO F F F O O F F F CH 3 F O O F F F CH 3
Price: Price on request EURO

Catalog Number: 2089

CAS: 2244087-17-8

Purity: 97%

Molecular Formula: C18H6F28O8S2

Molecular Weight: 946.32

Physical properties

Boiling Point, °C: 112-122/0,3 mm Hg

Additional information

SMILES: COC(=O)C(C(F)(F)F)(OC(C(C(F)(F)O)(OC(C(SSC(C(OC(C(OC(C(F)(F)F)(C(=O)OC)F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(F)F)F)(F)F)F
