Organofluorine chemistry:
science, technologies, manufacture since 1987
Heptafluoro-1,1-bis(trifluoromethyl)butylsulfenyl chloride
OBDepict S S F F F F F F F F F F F F F S F F F F F F F F F F F F F
Price: Price on request EURO

Catalog Number: 2092

Purity: 97%

Molecular Formula: C6ClF13S

Molecular Weight: 386.56

Physical properties
Additional information

SMILES: FC(C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)SSSC(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F)(F)F

Order