Organofluorine chemistry:
science, technologies, manufacture since 1987
OBDepict OH HO F F F F F F F F F F F F
Price: 1kg - 1159 EURO
In Stock: 1.19 kg
Capacity per Month: 50 kg

Catalog Number: 0774

CAS: 918-21-8

MDL number: MFCD00427700

Purity: 95%min

Molecular Formula: C6H2F12O2

Molecular Weight: 334.06

Physical properties

Melting Point, °C: 18-20

Boiling Point, °C: 128-129

Refractive Index, n20

Density, g/cm³: 1,86

Additional information


SMILES: OC(C(C(F)(F)F)(C(F)(F)F)O)(C(F)(F)F)C(F)(F)F
